cas: 35764-15-9 — see every product listed under this CAS number, including other names
2-Bromo-4-(trifluoromethyl)benzonitrile, 97%, 97% (CAS 35764-15-9) is a chemical reagent available from Chemat. Available pack sizes: 1kg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114GNF-1kg |
| cas | 35764-15-9 |
| size | 1kg |
| availability | 2000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1kg | 4005.20 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 131.60 Pln | |
| Chemat | 25g | 218.00 Pln | |
| Chemat | 100g | 674.00 Pln | |
| Chemat | 500g | 2520.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-bromo-4-(trifluoromethyl)benzonitrile (CAS 35764-15-9) is a chemical compound with the molecular formula C8H3BrF3N and a molecular weight of 250.01 g/mol. IUPAC name: 2-bromo-4-(trifluoromethyl)benzonitrile. InChIKey: YQDJZASWOJHHGY-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF3N |
|---|---|
| Molecular weight | 250.01 g/mol |
| IUPAC name | 2-bromo-4-(trifluoromethyl)benzonitrile |
| InChIKey | YQDJZASWOJHHGY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)Br)C#N |
Computed by PubChem (NCBI)