cas: 1244949-24-3 — see every product listed under this CAS number, including other names
2-Bromo-4-chloro-6-(trifluoromethoxy)aniline, 97%, 97% (CAS 1244949-24-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111M4H-100mg |
| cas | 1244949-24-3 |
| size | 100mg |
| availability | 14.7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 256.40 Pln | |
| Chemat | 5g | 885.20 Pln | |
| Chemat | 10g | 1653.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-bromo-4-chloro-6-(trifluoromethoxy)aniline (CAS 1244949-24-3) is a chemical compound with the molecular formula C7H4BrClF3NO and a molecular weight of 290.46 g/mol. IUPAC name: 2-bromo-4-chloro-6-(trifluoromethoxy)aniline. InChIKey: WYCAACPCJVGVOP-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClF3NO |
|---|---|
| Molecular weight | 290.46 g/mol |
| IUPAC name | 2-bromo-4-chloro-6-(trifluoromethoxy)aniline |
| InChIKey | WYCAACPCJVGVOP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1OC(F)(F)F)N)Br)Cl |
Computed by PubChem (NCBI)