cas: 41280-65-3 — see every product listed under this CAS number, including other names
2-Bromo-4-tert-butyl-1-methoxybenzene, 98%, 98% (CAS 41280-65-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1148VA-250mg |
| cas | 41280-65-3 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 155.60 Pln | |
| Chemat | 5g | 357.20 Pln | |
| Chemat | 25g | 1432.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-bromo-4-tert-butyl-1-methoxybenzene (CAS 41280-65-3) is a chemical compound with the molecular formula C11H15BrO and a molecular weight of 243.14 g/mol. IUPAC name: 2-bromo-4-tert-butyl-1-methoxybenzene. InChIKey: KBJMBOZJLNXKDI-UHFFFAOYSA-N.
| Molecular formula | C11H15BrO |
|---|---|
| Molecular weight | 243.14 g/mol |
| IUPAC name | 2-bromo-4-tert-butyl-1-methoxybenzene |
| InChIKey | KBJMBOZJLNXKDI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)OC)Br |
Computed by PubChem (NCBI)