CAS 528528-58-7 is the registry number for 1-Bromo-4-(neopentyloxy)benzene, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
1-bromo-4-(2,2-dimethylpropoxy)benzene (CAS 528528-58-7) is a chemical compound with the molecular formula C11H15BrO and a molecular weight of 243.14 g/mol. IUPAC name: 1-bromo-4-(2,2-dimethylpropoxy)benzene. InChIKey: AWFIDQHILKXJOV-UHFFFAOYSA-N.
| Molecular formula | C11H15BrO |
|---|---|
| Molecular weight | 243.14 g/mol |
| IUPAC name | 1-bromo-4-(2,2-dimethylpropoxy)benzene |
| InChIKey | AWFIDQHILKXJOV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)COC1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)