2-Bromo-5'-phenyl-1,1':3',1''-terphenyl, 98%
cas: 1890136-54-5 — see every product listed under this CAS number, including other names
2-Bromo-5'-phenyl-1,1':3',1''-terphenyl, 98% (CAS 1890136-54-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg. Offered by: Fluorochem, Ambeed, BLDpharm, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F864247-1G |
| cas | 1890136-54-5 |
| size | 1g |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 529.00 Pln | |
| Fluorochem | 5g | 1273.53 Pln | |
| Fluorochem | 10g | 2351.27 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 520.56 Pln | |
| Ambeed | 5g | 1738.75 Pln | |
| Ambeed | 10g | 3162.75 Pln | |
| BLDpharm | 100mg | 247.72 Pln | |
| BLDpharm | 250mg | 297.70 Pln | |
| BLDpharm | 1g | 553.16 Pln | |
| BLDpharm | 5g | 1869.37 Pln | |
| BLDpharm | 10g | 3402.16 Pln | |
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 170.00 Pln | |
| Chemat | 1g | 280.40 Pln | |
| Chemat | 5g | 794.00 Pln | |
| Chemat | 10g | 1365.20 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
1-(2-bromophenyl)-3,5-diphenylbenzene (CAS 1890136-54-5) is a chemical compound with the molecular formula C24H17Br and a molecular weight of 385.3 g/mol. IUPAC name: 1-(2-bromophenyl)-3,5-diphenylbenzene. InChIKey: JZTPJDDVFCPFKR-UHFFFAOYSA-N.
| Molecular formula | C24H17Br |
|---|---|
| Molecular weight | 385.3 g/mol |
| IUPAC name | 1-(2-bromophenyl)-3,5-diphenylbenzene |
| InChIKey | JZTPJDDVFCPFKR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC(=C2)C3=CC=CC=C3Br)C4=CC=CC=C4 |
Computed by PubChem (NCBI)