CAS 1233200-57-1 appears in our catalog under these names: 3–Bromo–5'–phenyl–1,1':3',1''–terphenyl, 3-Bromo-5'-phenyl-1,1':3',1''-terphenyl, >98.0%(GC), 3-Bromo-5'-phenyl-1,1':3',1''-terphenyl, 3-Bromo-5'-phenyl-1,1':3',1''-terphenyl, ≥98%(HPLC). Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 100g, 5g, 1g, 250mg.
1-(3-bromophenyl)-3,5-diphenylbenzene (CAS 1233200-57-1) is a chemical compound with the molecular formula C24H17Br and a molecular weight of 385.3 g/mol. IUPAC name: 1-(3-bromophenyl)-3,5-diphenylbenzene. InChIKey: RDSDKECSKZPOLF-UHFFFAOYSA-N.
| Molecular formula | C24H17Br |
|---|---|
| Molecular weight | 385.3 g/mol |
| IUPAC name | 1-(3-bromophenyl)-3,5-diphenylbenzene |
| InChIKey | RDSDKECSKZPOLF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC(=C2)C3=CC(=CC=C3)Br)C4=CC=CC=C4 |
Computed by PubChem (NCBI)