cas: 10513-26-5 — see every product listed under this CAS number, including other names
2-Bromo-5,5-dimethyl-5,6-dihydrobenzo[d]thiazol-7(4H)-one, 97%, 97% (CAS 10513-26-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1104KA-250mg |
| cas | 10513-26-5 |
| size | 250mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 683.60 Pln | |
| Chemat | 1g | 1869.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-bromo-5,5-dimethyl-4,6-dihydro-1,3-benzothiazol-7-one (CAS 10513-26-5) is a chemical compound with the molecular formula C9H10BrNOS and a molecular weight of 260.15 g/mol. IUPAC name: 2-bromo-5,5-dimethyl-4,6-dihydro-1,3-benzothiazol-7-one. InChIKey: YWEYODFGGPSBMP-UHFFFAOYSA-N.
| Molecular formula | C9H10BrNOS |
|---|---|
| Molecular weight | 260.15 g/mol |
| IUPAC name | 2-bromo-5,5-dimethyl-4,6-dihydro-1,3-benzothiazol-7-one |
| InChIKey | YWEYODFGGPSBMP-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C(=O)C1)SC(=N2)Br)C |
Computed by PubChem (NCBI)