cas: 694514-19-7 — see every product listed under this CAS number, including other names
2-Bromo-5-methoxy-4-(trifluoromethyl)aniline, 97% (CAS 694514-19-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F607546-250MG |
| cas | 694514-19-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 445.69 Pln | |
| Fluorochem | 1g | 1601.54 Pln | |
| Fluorochem | 5g | 4746.26 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-bromo-5-methoxy-4-(trifluoromethyl)aniline (CAS 694514-19-7) is a chemical compound with the molecular formula C8H7BrF3NO and a molecular weight of 270.05 g/mol. IUPAC name: 2-bromo-5-methoxy-4-(trifluoromethyl)aniline. InChIKey: NUFDHHXRRSOFSF-UHFFFAOYSA-N.
| Molecular formula | C8H7BrF3NO |
|---|---|
| Molecular weight | 270.05 g/mol |
| IUPAC name | 2-bromo-5-methoxy-4-(trifluoromethyl)aniline |
| InChIKey | NUFDHHXRRSOFSF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1C(F)(F)F)Br)N |
Computed by PubChem (NCBI)