Products 1516333-09-7
CAS 1516333-09-7 is the registry number for 3-Bromo-2-(2,2,2-trifluoroethoxy)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-bromo-2-(2,2,2-trifluoroethoxy)aniline (CAS 1516333-09-7) is a chemical compound with the molecular formula C8H7BrF3NO and a molecular weight of 270.05 g/mol. IUPAC name: 3-bromo-2-(2,2,2-trifluoroethoxy)aniline. InChIKey: OPLPSILDUXCMSR-UHFFFAOYSA-N.
| Molecular formula | C8H7BrF3NO |
|---|---|
| Molecular weight | 270.05 g/mol |
| IUPAC name | 3-bromo-2-(2,2,2-trifluoroethoxy)aniline |
| InChIKey | OPLPSILDUXCMSR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)OCC(F)(F)F)N |
Computed by PubChem (NCBI)