cas: 1805513-34-1 — see every product listed under this CAS number, including other names
2-Bromo-5-methoxy-4-nitropyridine, 95% (CAS 1805513-34-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F771245-100MG |
| cas | 1805513-34-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 763.29 Pln | |
| Fluorochem | 250mg | 1216.26 Pln | |
| Fluorochem | 1g | 2361.69 Pln | |
| Fluorochem | 5g | 5782.36 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-bromo-5-methoxy-4-nitropyridine (CAS 1805513-34-1) is a chemical compound with the molecular formula C6H5BrN2O3 and a molecular weight of 233.02 g/mol. IUPAC name: 2-bromo-5-methoxy-4-nitropyridine. InChIKey: WDXZTUWUDRHWQA-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN2O3 |
|---|---|
| Molecular weight | 233.02 g/mol |
| IUPAC name | 2-bromo-5-methoxy-4-nitropyridine |
| InChIKey | WDXZTUWUDRHWQA-UHFFFAOYSA-N |
| SMILES | COC1=CN=C(C=C1[N+](=O)[O-])Br |
Computed by PubChem (NCBI)