cas: 60323-98-0 — see every product listed under this CAS number, including other names
2-Bromo-5-methyl-4-nitropyridine 1-oxide 98% (CAS 60323-98-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A578153-250mg |
| cas | 60323-98-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 286.94 Pln | |
| Ambeed | 1g | 359.25 Pln | |
| Ambeed | 5g | 832.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A578153 |
2-bromo-5-methyl-4-nitro-1-oxidopyridin-1-ium (CAS 60323-98-0) is a chemical compound with the molecular formula C6H5BrN2O3 and a molecular weight of 233.02 g/mol. IUPAC name: 2-bromo-5-methyl-4-nitro-1-oxidopyridin-1-ium. InChIKey: LUUOUEOEHQBXSX-UHFFFAOYSA-N.
| Molecular formula | C6H5BrN2O3 |
|---|---|
| Molecular weight | 233.02 g/mol |
| IUPAC name | 2-bromo-5-methyl-4-nitro-1-oxidopyridin-1-ium |
| InChIKey | LUUOUEOEHQBXSX-UHFFFAOYSA-N |
| SMILES | CC1=C[N+](=C(C=C1[N+](=O)[O-])Br)[O-] |
Computed by PubChem (NCBI)