2-Bromo-6,9-diphenyl-9H-carbazole, 98%
cas: 1644466-58-9 — see every product listed under this CAS number, including other names
2-Bromo-6,9-diphenyl-9H-carbazole, 98% (CAS 1644466-58-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem, Ambeed, BLDpharm, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F865129-250MG |
| cas | 1644466-58-9 |
| size | 250mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 143.72 Pln | |
| Fluorochem | 1g | 232.23 Pln | |
| Fluorochem | 5g | 685.19 Pln | |
| Fluorochem | 10g | 1169.40 Pln | |
| Ambeed | 250mg | 170.12 Pln | |
| Ambeed | 1g | 236.88 Pln | |
| Ambeed | 5g | 759.75 Pln | |
| BLDpharm | 250mg | 153.30 Pln | |
| BLDpharm | 1g | 253.27 Pln | |
| BLDpharm | 5g | 919.70 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 5g | 414.80 Pln | |
| Chemat | 10g | 702.80 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
2-bromo-6,9-diphenylcarbazole (CAS 1644466-58-9) is a chemical compound with the molecular formula C24H16BrN and a molecular weight of 398.3 g/mol. IUPAC name: 2-bromo-6,9-diphenylcarbazole. InChIKey: JMCFQQYVNWNMOM-UHFFFAOYSA-N.
| Molecular formula | C24H16BrN |
|---|---|
| Molecular weight | 398.3 g/mol |
| IUPAC name | 2-bromo-6,9-diphenylcarbazole |
| InChIKey | JMCFQQYVNWNMOM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC3=C(C=C2)N(C4=C3C=CC(=C4)Br)C5=CC=CC=C5 |
Computed by PubChem (NCBI)