Products 2414672-95-8
CAS 2414672-95-8 is the registry number for 3-(4-Bromo-9-phenyl-9H-fluoren-9-yl)pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-bromo-9-phenylfluoren-9-yl)pyridine (CAS 2414672-95-8) is a chemical compound with the molecular formula C24H16BrN and a molecular weight of 398.3 g/mol. IUPAC name: 3-(4-bromo-9-phenylfluoren-9-yl)pyridine. InChIKey: SYNCDSCASANKTE-UHFFFAOYSA-N.
| Molecular formula | C24H16BrN |
|---|---|
| Molecular weight | 398.3 g/mol |
| IUPAC name | 3-(4-bromo-9-phenylfluoren-9-yl)pyridine |
| InChIKey | SYNCDSCASANKTE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2(C3=C(C4=CC=CC=C42)C(=CC=C3)Br)C5=CN=CC=C5 |
Computed by PubChem (NCBI)