cas: 898748-23-7 — see every product listed under this CAS number, including other names
2-Bromo-6-(trifluoromethyl)benzo[d]thiazole 98% (CAS 898748-23-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A785378-100mg |
| cas | 898748-23-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 231.31 Pln | |
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 843.19 Pln | |
| Ambeed | 5g | 2784.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A785378 |
2-bromo-6-(trifluoromethyl)-1,3-benzothiazole (CAS 898748-23-7) is a chemical compound with the molecular formula C8H3BrF3NS and a molecular weight of 282.08 g/mol. IUPAC name: 2-bromo-6-(trifluoromethyl)-1,3-benzothiazole. InChIKey: RFNZUTHSKMWKOR-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF3NS |
|---|---|
| Molecular weight | 282.08 g/mol |
| IUPAC name | 2-bromo-6-(trifluoromethyl)-1,3-benzothiazole |
| InChIKey | RFNZUTHSKMWKOR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)SC(=N2)Br |
Computed by PubChem (NCBI)