Products 1823516-41-1
CAS 1823516-41-1 is the registry number for 2-Bromo-1-thiocyanato-3-trifluoromethyl-benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 25g, 1g, 5g.
[2-bromo-3-(trifluoromethyl)phenyl] thiocyanate (CAS 1823516-41-1) is a chemical compound with the molecular formula C8H3BrF3NS and a molecular weight of 282.08 g/mol. IUPAC name: [2-bromo-3-(trifluoromethyl)phenyl] thiocyanate. InChIKey: XPRDEYTYUMRBPF-UHFFFAOYSA-N.
| Molecular formula | C8H3BrF3NS |
|---|---|
| Molecular weight | 282.08 g/mol |
| IUPAC name | [2-bromo-3-(trifluoromethyl)phenyl] thiocyanate |
| InChIKey | XPRDEYTYUMRBPF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)SC#N)Br)C(F)(F)F |
Computed by PubChem (NCBI)