cas: 117519-16-1 — see every product listed under this CAS number, including other names
2-Bromo-6-(trifluoromethyl)pyridin-3-amine, 98% (CAS 117519-16-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F228254-1G |
| cas | 117519-16-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 419.66 Pln | |
| Fluorochem | 10g | 758.08 Pln | |
| Fluorochem | 25g | 1424.52 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
2-bromo-6-(trifluoromethyl)pyridin-3-amine (CAS 117519-16-1) is a chemical compound with the molecular formula C6H4BrF3N2 and a molecular weight of 241.01 g/mol. IUPAC name: 2-bromo-6-(trifluoromethyl)pyridin-3-amine. InChIKey: NCOWBQRCCMJSKW-UHFFFAOYSA-N.
| Molecular formula | C6H4BrF3N2 |
|---|---|
| Molecular weight | 241.01 g/mol |
| IUPAC name | 2-bromo-6-(trifluoromethyl)pyridin-3-amine |
| InChIKey | NCOWBQRCCMJSKW-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1N)Br)C(F)(F)F |
Computed by PubChem (NCBI)