Products 1206524-20-0
CAS 1206524-20-0 is the registry number for 2-(Bromomethyl)-3-(trifluoromethyl)pyrazine, 98%. Offered by: AmBeed. Available pack sizes: 250mg.
2-(bromomethyl)-3-(trifluoromethyl)pyrazine (CAS 1206524-20-0) is a chemical compound with the molecular formula C6H4BrF3N2 and a molecular weight of 241.01 g/mol. IUPAC name: 2-(bromomethyl)-3-(trifluoromethyl)pyrazine. InChIKey: PDJAQWQRBJDVNK-UHFFFAOYSA-N.
| Molecular formula | C6H4BrF3N2 |
|---|---|
| Molecular weight | 241.01 g/mol |
| IUPAC name | 2-(bromomethyl)-3-(trifluoromethyl)pyrazine |
| InChIKey | PDJAQWQRBJDVNK-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=N1)CBr)C(F)(F)F |
Computed by PubChem (NCBI)