cas: 16618-66-9 — see every product listed under this CAS number, including other names
2-Bromo-6-Methoxy-4-nitroaniline, 97%, 97% (CAS 16618-66-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112WJP-250mg |
| cas | 16618-66-9 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 189.20 Pln | |
| Chemat | 5g | 501.20 Pln | |
| Chemat | 25g | 1850.00 Pln | |
| Chemat | 100mg | 98.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-bromo-6-methoxy-4-nitroaniline (CAS 16618-66-9) is a chemical compound with the molecular formula C7H7BrN2O3 and a molecular weight of 247.05 g/mol. IUPAC name: 2-bromo-6-methoxy-4-nitroaniline. InChIKey: QYLWEPIKPMUYAW-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN2O3 |
|---|---|
| Molecular weight | 247.05 g/mol |
| IUPAC name | 2-bromo-6-methoxy-4-nitroaniline |
| InChIKey | QYLWEPIKPMUYAW-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)[N+](=O)[O-])Br)N |
Computed by PubChem (NCBI)