Products 1820704-59-3
CAS 1820704-59-3 is the registry number for 2-Amino-5-bromo-4-methoxy-nicotinic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
2-amino-5-bromo-4-methoxypyridine-3-carboxylic acid (CAS 1820704-59-3) is a chemical compound with the molecular formula C7H7BrN2O3 and a molecular weight of 247.05 g/mol. IUPAC name: 2-amino-5-bromo-4-methoxypyridine-3-carboxylic acid. InChIKey: RBUXLKSMJCCIDN-UHFFFAOYSA-N.
| Molecular formula | C7H7BrN2O3 |
|---|---|
| Molecular weight | 247.05 g/mol |
| IUPAC name | 2-amino-5-bromo-4-methoxypyridine-3-carboxylic acid |
| InChIKey | RBUXLKSMJCCIDN-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=NC=C1Br)N)C(=O)O |
Computed by PubChem (NCBI)