cas: 66217-20-7 — see every product listed under this CAS number, including other names
2-Bromo-6-butoxynaphthalene, ≥95%, ≥95% (CAS 66217-20-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114GR4-250mg |
| cas | 66217-20-7 |
| size | 250mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 122.00 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 328.40 Pln | |
| Chemat | 10g | 592.40 Pln | |
| Chemat | 25g | 1149.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
2-bromo-6-butoxynaphthalene (CAS 66217-20-7) is a chemical compound with the molecular formula C14H15BrO and a molecular weight of 279.17 g/mol. IUPAC name: 2-bromo-6-butoxynaphthalene. InChIKey: LIQQRPRDWMYCPK-UHFFFAOYSA-N.
| Molecular formula | C14H15BrO |
|---|---|
| Molecular weight | 279.17 g/mol |
| IUPAC name | 2-bromo-6-butoxynaphthalene |
| InChIKey | LIQQRPRDWMYCPK-UHFFFAOYSA-N |
| SMILES | CCCCOC1=CC2=C(C=C1)C=C(C=C2)Br |
Computed by PubChem (NCBI)