CAS 1363386-56-4 appears in our catalog under these names: 2-Bromo-6-(2-methylpropoxy)naphthalene, 97%, 2-Bromo-6-iso-butyloxynaphthalene. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 25g, 5g, 1g.
2-bromo-6-(2-methylpropoxy)naphthalene (CAS 1363386-56-4) is a chemical compound with the molecular formula C14H15BrO and a molecular weight of 279.17 g/mol. IUPAC name: 2-bromo-6-(2-methylpropoxy)naphthalene. InChIKey: ICQYHDZGHQBAKN-UHFFFAOYSA-N.
| Molecular formula | C14H15BrO |
|---|---|
| Molecular weight | 279.17 g/mol |
| IUPAC name | 2-bromo-6-(2-methylpropoxy)naphthalene |
| InChIKey | ICQYHDZGHQBAKN-UHFFFAOYSA-N |
| SMILES | CC(C)COC1=CC2=C(C=C1)C=C(C=C2)Br |
Computed by PubChem (NCBI)