cas: 823221-94-9 — see every product listed under this CAS number, including other names
2-Bromo-6-chloro-4-(trifluoromethyl)pyridine 95% (CAS 823221-94-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A788633-50mg |
| cas | 823221-94-9 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 776.44 Pln | |
| Ambeed | 100mg | 1271.50 Pln | |
| Ambeed | 250mg | 1989.06 Pln | |
| Ambeed | 1g | 3885.87 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A788633 |
2-bromo-6-chloro-4-(trifluoromethyl)pyridine (CAS 823221-94-9) is a chemical compound with the molecular formula C6H2BrClF3N and a molecular weight of 260.44 g/mol. IUPAC name: 2-bromo-6-chloro-4-(trifluoromethyl)pyridine. InChIKey: SXRSZRYSSRIZNG-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClF3N |
|---|---|
| Molecular weight | 260.44 g/mol |
| IUPAC name | 2-bromo-6-chloro-4-(trifluoromethyl)pyridine |
| InChIKey | SXRSZRYSSRIZNG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1Cl)Br)C(F)(F)F |
Computed by PubChem (NCBI)