CAS 823221-94-9 appears in our catalog under these names: 2-Bromo-6-chloro-4-(trifluoromethyl)pyridine, 95%, 2-Bromo-6-chloro-4-(trifluoromethyl)pyridine, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 50mg, 100mg.
2-bromo-6-chloro-4-(trifluoromethyl)pyridine (CAS 823221-94-9) is a chemical compound with the molecular formula C6H2BrClF3N and a molecular weight of 260.44 g/mol. IUPAC name: 2-bromo-6-chloro-4-(trifluoromethyl)pyridine. InChIKey: SXRSZRYSSRIZNG-UHFFFAOYSA-N.
| Molecular formula | C6H2BrClF3N |
|---|---|
| Molecular weight | 260.44 g/mol |
| IUPAC name | 2-bromo-6-chloro-4-(trifluoromethyl)pyridine |
| InChIKey | SXRSZRYSSRIZNG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1Cl)Br)C(F)(F)F |
Computed by PubChem (NCBI)