2-Bromo-6-fluoro-4-nitroaniline, 97%
cas: 455-58-3 — see every product listed under this CAS number, including other names
2-Bromo-6-fluoro-4-nitroaniline, 97% (CAS 455-58-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 5g, 1g, 10g, 100g, 250mg. Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat.
| brand | Combi-blocks |
|---|---|
| catalog number | AN-2920-25g |
| cas | 455-58-3 |
| size | 25g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 1g | 211.40 Pln | |
| Fluorochem | 5g | 393.63 Pln | |
| Fluorochem | 10g | 555.03 Pln | |
| Fluorochem | 25g | 1054.85 Pln | |
| Fluorochem | 100g | 3798.68 Pln | |
| Ambeed | 250mg | 164.56 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 420.44 Pln | |
| Ambeed | 10g | 592.88 Pln | |
| Ambeed | 25g | 1115.75 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 347.60 Pln | |
| Chemat | 10g | 597.20 Pln | |
| Chemat | 25g | 1139.60 Pln | |
| BLDpharm | 250mg | 142.20 Pln | |
| BLDpharm | 1g | 231.05 Pln | |
| BLDpharm | 5g | 414.32 Pln | |
| BLDpharm | 10g | 580.93 Pln | |
| BLDpharm | 25g | 1097.42 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
2-bromo-6-fluoro-4-nitroaniline (CAS 455-58-3) is a chemical compound with the molecular formula C6H4BrFN2O2 and a molecular weight of 235.01 g/mol. IUPAC name: 2-bromo-6-fluoro-4-nitroaniline. InChIKey: YAQFGXYPGJATMT-UHFFFAOYSA-N.
| Molecular formula | C6H4BrFN2O2 |
|---|---|
| Molecular weight | 235.01 g/mol |
| IUPAC name | 2-bromo-6-fluoro-4-nitroaniline |
| InChIKey | YAQFGXYPGJATMT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)N)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)