CAS 1313588-93-0 appears in our catalog under these names: 5-Bromo-2-fluoro-3-nitroaniline, 96%, 5-Bromo-2-fluoro-3-nitroaniline. Offered by: Combi-blocks, TRC, Fluorochem. Available pack sizes: 1g, 250mg.
5-bromo-2-fluoro-3-nitroaniline (CAS 1313588-93-0) is a chemical compound with the molecular formula C6H4BrFN2O2 and a molecular weight of 235.01 g/mol. IUPAC name: 5-bromo-2-fluoro-3-nitroaniline. InChIKey: KHADFTHWUPIKQM-UHFFFAOYSA-N.
| Molecular formula | C6H4BrFN2O2 |
|---|---|
| Molecular weight | 235.01 g/mol |
| IUPAC name | 5-bromo-2-fluoro-3-nitroaniline |
| InChIKey | KHADFTHWUPIKQM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1N)F)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)