cas: 329-49-7 — see every product listed under this CAS number, including other names
2-Bromo-6-fluoro-4-nitrophenol (CAS 329-49-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F035769-1G |
| cas | 329-49-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 445.69 Pln | |
| Fluorochem | 5g | 456.11 Pln | |
| Fluorochem | 10g | 862.21 Pln | |
| Fluorochem | 25g | 1299.56 Pln |
| delivery time | 3-4 weeks |
|---|
2-bromo-6-fluoro-4-nitrophenol (CAS 329-49-7) is a chemical compound with the molecular formula C6H3BrFNO3 and a molecular weight of 235.99 g/mol. IUPAC name: 2-bromo-6-fluoro-4-nitrophenol. InChIKey: YJBBEHQOMCJIGN-UHFFFAOYSA-N.
| Molecular formula | C6H3BrFNO3 |
|---|---|
| Molecular weight | 235.99 g/mol |
| IUPAC name | 2-bromo-6-fluoro-4-nitrophenol |
| InChIKey | YJBBEHQOMCJIGN-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)O)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)