Products 1805031-72-4
CAS 1805031-72-4 is the registry number for 4-Bromo-2-fluoro-3-nitrophenol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
4-bromo-2-fluoro-3-nitrophenol (CAS 1805031-72-4) is a chemical compound with the molecular formula C6H3BrFNO3 and a molecular weight of 235.99 g/mol. IUPAC name: 4-bromo-2-fluoro-3-nitrophenol. InChIKey: SPHBRVIRUKILRH-UHFFFAOYSA-N.
| Molecular formula | C6H3BrFNO3 |
|---|---|
| Molecular weight | 235.99 g/mol |
| IUPAC name | 4-bromo-2-fluoro-3-nitrophenol |
| InChIKey | SPHBRVIRUKILRH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1O)F)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)