2-Bromo-6-fluoronaphthalene, 96%
cas: 324-41-4 — see every product listed under this CAS number, including other names
2-Bromo-6-fluoronaphthalene, 96% (CAS 324-41-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A126199-250mg |
| cas | 324-41-4 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 325.88 Pln | |
| Ambeed | 5g | 776.44 Pln | |
| Ambeed | 10g | 1471.75 Pln | |
| Ambeed | 25g | 3246.19 Pln | |
| BLDpharm | 250mg | 214.39 Pln | |
| BLDpharm | 1g | 342.13 Pln | |
| BLDpharm | 5g | 830.84 Pln | |
| BLDpharm | 10g | 1580.58 Pln | |
| BLDpharm | 25g | 3491.02 Pln | |
| Fluorochem | 250mg | 195.78 Pln | |
| Fluorochem | 1g | 320.74 Pln | |
| Fluorochem | 5g | 773.70 Pln | |
| Fluorochem | 10g | 1476.58 Pln | |
| Fluorochem | 25g | 3215.55 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
2-bromo-6-fluoronaphthalene (CAS 324-41-4) is a chemical compound with the molecular formula C10H6BrF and a molecular weight of 225.06 g/mol. IUPAC name: 2-bromo-6-fluoronaphthalene. InChIKey: CAJAZWLCCNCVEY-UHFFFAOYSA-N.
| Molecular formula | C10H6BrF |
|---|---|
| Molecular weight | 225.06 g/mol |
| IUPAC name | 2-bromo-6-fluoronaphthalene |
| InChIKey | CAJAZWLCCNCVEY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=C2)Br)C=C1F |
Computed by PubChem (NCBI)