cas: 2941-58-4 — see every product listed under this CAS number, including other names
2-Bromo-6-methoxybenzothiazole 95% (CAS 2941-58-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A207249-250mg |
| cas | 2941-58-4 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 203.50 Pln | |
| Ambeed | 10g | 325.88 Pln | |
| Ambeed | 25g | 448.25 Pln | |
| Ambeed | 100g | 1560.75 Pln | |
| Ambeed | 500g | 6038.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A207249 |
2-bromo-6-methoxy-1,3-benzothiazole (CAS 2941-58-4) is a chemical compound with the molecular formula C8H6BrNOS and a molecular weight of 244.11 g/mol. IUPAC name: 2-bromo-6-methoxy-1,3-benzothiazole. InChIKey: YNONWDJSSPJFBQ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNOS |
|---|---|
| Molecular weight | 244.11 g/mol |
| IUPAC name | 2-bromo-6-methoxy-1,3-benzothiazole |
| InChIKey | YNONWDJSSPJFBQ-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N=C(S2)Br |
Computed by PubChem (NCBI)