CAS 1891048-05-7 is the registry number for 5-(4-Bromothiophen-2-yl)-3-methylisoxazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(4-bromothiophen-2-yl)-3-methyl-1,2-oxazole (CAS 1891048-05-7) is a chemical compound with the molecular formula C8H6BrNOS and a molecular weight of 244.11 g/mol. IUPAC name: 5-(4-bromothiophen-2-yl)-3-methyl-1,2-oxazole. InChIKey: OXZAUODJDGXGBJ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNOS |
|---|---|
| Molecular weight | 244.11 g/mol |
| IUPAC name | 5-(4-bromothiophen-2-yl)-3-methyl-1,2-oxazole |
| InChIKey | OXZAUODJDGXGBJ-UHFFFAOYSA-N |
| SMILES | CC1=NOC(=C1)C2=CC(=CS2)Br |
Computed by PubChem (NCBI)