2-Bromo-8-chloroquinoline, 97%
cas: 891842-52-7 — see every product listed under this CAS number, including other names
2-Bromo-8-chloroquinoline, 97% (CAS 891842-52-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 250mg, 2.5g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A714283-1g |
| cas | 891842-52-7 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 337.00 Pln | |
| Ambeed | 5g | 865.44 Pln | |
| Ambeed | 10g | 1393.88 Pln | |
| Ambeed | 25g | 2612.06 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 353.23 Pln | |
| BLDpharm | 5g | 925.25 Pln | |
| BLDpharm | 10g | 1497.28 Pln | |
| BLDpharm | 25g | 2807.92 Pln | |
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 1g | 336.36 Pln | |
| Fluorochem | 2.5g | 544.62 Pln | |
| Fluorochem | 5g | 888.25 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
2-bromo-8-chloroquinoline (CAS 891842-52-7) is a chemical compound with the molecular formula C9H5BrClN and a molecular weight of 242.50 g/mol. IUPAC name: 2-bromo-8-chloroquinoline. InChIKey: QSVCZJXVMARGOP-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClN |
|---|---|
| Molecular weight | 242.50 g/mol |
| IUPAC name | 2-bromo-8-chloroquinoline |
| InChIKey | QSVCZJXVMARGOP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)N=C(C=C2)Br |
Computed by PubChem (NCBI)