CAS 1070879-30-9 appears in our catalog under these names: 4-Bromo-6-chloroquinoline, 97%, 4–Bromo–6–chloroquinoline. Offered by: Combi-blocks, GLPBio, Fluorochem, Ambeed. Available pack sizes: 10g, 1g, 5g, 250mg, 100mg.
4-bromo-6-chloroquinoline (CAS 1070879-30-9) is a chemical compound with the molecular formula C9H5BrClN and a molecular weight of 242.50 g/mol. IUPAC name: 4-bromo-6-chloroquinoline. InChIKey: FEBLUGZKVJAOLT-UHFFFAOYSA-N.
| Molecular formula | C9H5BrClN |
|---|---|
| Molecular weight | 242.50 g/mol |
| IUPAC name | 4-bromo-6-chloroquinoline |
| InChIKey | FEBLUGZKVJAOLT-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=CC(=C2C=C1Cl)Br |
Computed by PubChem (NCBI)