cas: 863118-14-3 — see every product listed under this CAS number, including other names
2-Bromo-N-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)acetamide, 98%, 98% (CAS 863118-14-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch115MBP-250mg |
| cas | 863118-14-3 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 362.00 Pln | |
| Chemat | 5g | 966.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-bromo-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide (CAS 863118-14-3) is a chemical compound with the molecular formula C14H19BBrNO3 and a molecular weight of 340.02 g/mol. IUPAC name: 2-bromo-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide. InChIKey: DIFPHULVCKBACZ-UHFFFAOYSA-N.
| Molecular formula | C14H19BBrNO3 |
|---|---|
| Molecular weight | 340.02 g/mol |
| IUPAC name | 2-bromo-N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
| InChIKey | DIFPHULVCKBACZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)NC(=O)CBr |
Computed by PubChem (NCBI)