CAS 2096338-51-9 is the registry number for 2-(Bromoacetamido)phenylboronic acid pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-bromo-N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide (CAS 2096338-51-9) is a chemical compound with the molecular formula C14H19BBrNO3 and a molecular weight of 340.02 g/mol. IUPAC name: 2-bromo-N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide. InChIKey: OXOVFHBKXUNIEM-UHFFFAOYSA-N.
| Molecular formula | C14H19BBrNO3 |
|---|---|
| Molecular weight | 340.02 g/mol |
| IUPAC name | 2-bromo-N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetamide |
| InChIKey | OXOVFHBKXUNIEM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2NC(=O)CBr |
Computed by PubChem (NCBI)