CAS 86-76-0 appears in our catalog under these names: 2-Bromodibenzofuran, >95% (HPLC), 2–bromodibenzofuran, 2-Bromodibenzofuran, 98% , 2-Bromodibenzofuran, >98.0%(GC), 2-Bromodibenzo[b,d]furan 98%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 1g, 2,5g, 250mg, 100g, 500g, 5g, 1000g, 10g.
2-bromodibenzofuran (CAS 86-76-0) is a chemical compound with the molecular formula C12H7BrO and a molecular weight of 247.09 g/mol. IUPAC name: 2-bromodibenzofuran. InChIKey: CRJISNQTZDMKQD-UHFFFAOYSA-N.
| Molecular formula | C12H7BrO |
|---|---|
| Molecular weight | 247.09 g/mol |
| IUPAC name | 2-bromodibenzofuran |
| InChIKey | CRJISNQTZDMKQD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C=CC(=C3)Br |
Computed by PubChem (NCBI)