CAS 89827-45-2 appears in our catalog under these names: 4–Bromodibenzofuran, 4-Bromodibenzofuran, >98.0%(GC), 4-Bromodibenzo[b,d]furan 97%, 4-Bromodibenzofuran, 97%, 97%, 4-Bromodibenzo[b,d]furan, 95%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 100g, 500g, 50g, 250g.
4-bromodibenzofuran (CAS 89827-45-2) is a chemical compound with the molecular formula C12H7BrO and a molecular weight of 247.09 g/mol. IUPAC name: 4-bromodibenzofuran. InChIKey: DYTYBRPMNQQFFL-UHFFFAOYSA-N.
| Molecular formula | C12H7BrO |
|---|---|
| Molecular weight | 247.09 g/mol |
| IUPAC name | 4-bromodibenzofuran |
| InChIKey | DYTYBRPMNQQFFL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C(=CC=C3)Br |
Computed by PubChem (NCBI)