cas: 2096332-85-1 — see every product listed under this CAS number, including other names
2-Butoxy-3-chloropyridine-4-boronic acid, 97%, 97% (CAS 2096332-85-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EHM1-250mg |
| cas | 2096332-85-1 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 314.00 Pln | |
| Chemat | 1g | 688.40 Pln | |
| Chemat | 5g | 1946.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2-butoxy-3-chloro-4-pyridinyl)boronic acid (CAS 2096332-85-1) is a chemical compound with the molecular formula C9H13BClNO3 and a molecular weight of 229.47 g/mol. IUPAC name: (2-butoxy-3-chloro-4-pyridinyl)boronic acid. InChIKey: KAQJIVQWEZWPBS-UHFFFAOYSA-N.
| Molecular formula | C9H13BClNO3 |
|---|---|
| Molecular weight | 229.47 g/mol |
| IUPAC name | (2-butoxy-3-chloro-4-pyridinyl)boronic acid |
| InChIKey | KAQJIVQWEZWPBS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=NC=C1)OCCCC)Cl)(O)O |
Computed by PubChem (NCBI)