Products 1217501-42-2

CAS 1217501-42-2 is the registry number for 5-Chloro-2-isobutoxypyridine-3-boronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.

Structural formula: {0} (CAS {1})

[5-chloro-2-(2-methylpropoxy)-3-pyridinyl]boronic acid (CAS 1217501-42-2) is a chemical compound with the molecular formula C9H13BClNO3 and a molecular weight of 229.47 g/mol. IUPAC name: [5-chloro-2-(2-methylpropoxy)-3-pyridinyl]boronic acid. InChIKey: RMJKPMVBIIUTRL-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13BClNO3
Molecular weight229.47 g/mol
IUPAC name[5-chloro-2-(2-methylpropoxy)-3-pyridinyl]boronic acid
InChIKeyRMJKPMVBIIUTRL-UHFFFAOYSA-N
SMILESB(C1=CC(=CN=C1OCC(C)C)Cl)(O)O

Computed by PubChem (NCBI)