cas: 151257-01-1 — see every product listed under this CAS number, including other names
2-Butyl-1,3-diazaspiro[4.4]non-1-en-4-one hydrochloride, 98%, 98% (CAS 151257-01-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 250g, 500g, 1kg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112N8F-5g |
| cas | 151257-01-1 |
| size | 5g |
| availability | 2000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 102.80 Pln | |
| Chemat | 50g | 131.60 Pln | |
| Chemat | 100g | 170.00 Pln | |
| Chemat | 250g | 309.20 Pln | |
| Chemat | 500g | 547.20 Pln | |
| Chemat | 1kg | 870.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-butyl-1,3-diazaspiro[4.4]non-1-en-4-one;hydrochloride (CAS 151257-01-1) is a chemical compound with the molecular formula C11H19ClN2O and a molecular weight of 230.73 g/mol. IUPAC name: 2-butyl-1,3-diazaspiro[4.4]non-1-en-4-one;hydrochloride. InChIKey: WWRHZLCKSVQRBG-UHFFFAOYSA-N.
| Molecular formula | C11H19ClN2O |
|---|---|
| Molecular weight | 230.73 g/mol |
| IUPAC name | 2-butyl-1,3-diazaspiro[4.4]non-1-en-4-one;hydrochloride |
| InChIKey | WWRHZLCKSVQRBG-UHFFFAOYSA-N |
| SMILES | CCCCC1=NC2(CCCC2)C(=O)N1.Cl |
Computed by PubChem (NCBI)