CAS 151257-01-1 appears in our catalog under these names: Irbesartan Impurity 11 HCl, 2-Butyl-1,3-diazaspiro(4.4)non-1-en-4-one Hydrochloride, 2–Butyl–1,3–diazaspiro(4·4)non–1–en–4–one Hydrochloride, 2-n-Butyl-1,3-diaza-spiro(4,4)non-1-en-4-one HCl, 2-Butyl-1,3-diazaspiro[4.4]non-1-en-4-one hydrochloride 98%. Offered by: Chemat Brand, TRC, Mikromol, GLPBio, Biosynth. Available pack sizes: on request, 50mg, 25mg, 100g, 25g, 500g, 2kg, 5kg.
2-butyl-1,3-diazaspiro[4.4]non-1-en-4-one;hydrochloride (CAS 151257-01-1) is a chemical compound with the molecular formula C11H19ClN2O and a molecular weight of 230.73 g/mol. IUPAC name: 2-butyl-1,3-diazaspiro[4.4]non-1-en-4-one;hydrochloride. InChIKey: WWRHZLCKSVQRBG-UHFFFAOYSA-N.
| Molecular formula | C11H19ClN2O |
|---|---|
| Molecular weight | 230.73 g/mol |
| IUPAC name | 2-butyl-1,3-diazaspiro[4.4]non-1-en-4-one;hydrochloride |
| InChIKey | WWRHZLCKSVQRBG-UHFFFAOYSA-N |
| SMILES | CCCCC1=NC2(CCCC2)C(=O)N1.Cl |
Computed by PubChem (NCBI)