cas: 70682-09-6 — see every product listed under this CAS number, including other names
2-CHLORO-3-(METHYLSULFONYL)PYRIDINE (CAS 70682-09-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F467397-1G |
| cas | 70682-09-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2439.78 Pln | |
| Fluorochem | 5g | 7162.08 Pln |
| delivery time | 3-4 weeks |
|---|
2-chloro-3-methylsulfonylpyridine (CAS 70682-09-6) is a chemical compound with the molecular formula C6H6ClNO2S and a molecular weight of 191.64 g/mol. IUPAC name: 2-chloro-3-methylsulfonylpyridine. InChIKey: KRGYYSGWNZRJPY-UHFFFAOYSA-N.
| Molecular formula | C6H6ClNO2S |
|---|---|
| Molecular weight | 191.64 g/mol |
| IUPAC name | 2-chloro-3-methylsulfonylpyridine |
| InChIKey | KRGYYSGWNZRJPY-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=C(N=CC=C1)Cl |
Computed by PubChem (NCBI)