Products 1194374-29-2

CAS 1194374-29-2 appears in our catalog under these names: 2-Chloro-5-ethyl-1,3-thiazole-4-carboxylic acid, 95%, 2-chloro-5-ethyl-1,3-thiazole-4-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-chloro-5-ethyl-1,3-thiazole-4-carboxylic acid (CAS 1194374-29-2) is a chemical compound with the molecular formula C6H6ClNO2S and a molecular weight of 191.64 g/mol. IUPAC name: 2-chloro-5-ethyl-1,3-thiazole-4-carboxylic acid. InChIKey: RVBBBKNEWQFTQF-UHFFFAOYSA-N.

Identity
Molecular formulaC6H6ClNO2S
Molecular weight191.64 g/mol
IUPAC name2-chloro-5-ethyl-1,3-thiazole-4-carboxylic acid
InChIKeyRVBBBKNEWQFTQF-UHFFFAOYSA-N
SMILESCCC1=C(N=C(S1)Cl)C(=O)O

Computed by PubChem (NCBI)