cas: 91668-83-6 — see every product listed under this CAS number, including other names
2-CHLORO-3-METHYLPYRIDINE N-OXIDE, 98+%, 98+% (CAS 91668-83-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1147T3-250mg |
| cas | 91668-83-6 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 323.60 Pln | |
| Chemat | 1g | 717.20 Pln | |
| Chemat | 5g | 2022.80 Pln | |
| Chemat | 10g | 3333.20 Pln |
| purity | 98+% |
|---|---|
| delivery time | 3 weeks |
2-chloro-3-methyl-1-oxidopyridin-1-ium (CAS 91668-83-6) is a chemical compound with the molecular formula C6H6ClNO and a molecular weight of 143.57 g/mol. IUPAC name: 2-chloro-3-methyl-1-oxidopyridin-1-ium. InChIKey: ZGHMADNNOPPAJO-UHFFFAOYSA-N.
| Molecular formula | C6H6ClNO |
|---|---|
| Molecular weight | 143.57 g/mol |
| IUPAC name | 2-chloro-3-methyl-1-oxidopyridin-1-ium |
| InChIKey | ZGHMADNNOPPAJO-UHFFFAOYSA-N |
| SMILES | CC1=C([N+](=CC=C1)[O-])Cl |
Computed by PubChem (NCBI)