CAS 91668-83-6 appears in our catalog under these names: 2-Chloro-3-methylpyridine 1-oxide, 98%, 2-CHLORO-3-METHYLPYRIDINE N-OXIDE, 98+%, 98+%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 25g, 1g, 10g, 250mg.
2-chloro-3-methyl-1-oxidopyridin-1-ium (CAS 91668-83-6) is a chemical compound with the molecular formula C6H6ClNO and a molecular weight of 143.57 g/mol. IUPAC name: 2-chloro-3-methyl-1-oxidopyridin-1-ium. InChIKey: ZGHMADNNOPPAJO-UHFFFAOYSA-N.
| Molecular formula | C6H6ClNO |
|---|---|
| Molecular weight | 143.57 g/mol |
| IUPAC name | 2-chloro-3-methyl-1-oxidopyridin-1-ium |
| InChIKey | ZGHMADNNOPPAJO-UHFFFAOYSA-N |
| SMILES | CC1=C([N+](=CC=C1)[O-])Cl |
Computed by PubChem (NCBI)