cas: 92-39-7 — see every product listed under this CAS number, including other names
2-Chloro-10H-phenothiazine, 98%, 98% (CAS 92-39-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114H43-10g |
| cas | 92-39-7 |
| size | 10g |
| availability | 11000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 74.00 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 100g | 117.20 Pln | |
| Chemat | 500g | 403.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-chloro-10H-phenothiazine (CAS 92-39-7) is a chemical compound with the molecular formula C12H8ClNS and a molecular weight of 233.72 g/mol. IUPAC name: 2-chloro-10H-phenothiazine. InChIKey: KFZGLJSYQXZIGP-UHFFFAOYSA-N.
| Molecular formula | C12H8ClNS |
|---|---|
| Molecular weight | 233.72 g/mol |
| IUPAC name | 2-chloro-10H-phenothiazine |
| InChIKey | KFZGLJSYQXZIGP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC3=C(S2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)