cas: 92-39-7 — see every product listed under this CAS number, including other names
2-Chlorophenothiazine, 99.87% (CAS 92-39-7) is a chemical reagent available from Chemat. Available pack sizes: 100 g, 50 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-Y1749-100 g |
| cas | 92-39-7 |
| size | 100 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 g | 356.84 Pln | |
| MedChemExpress | 50 g | 263.96 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.87% |
2-chloro-10H-phenothiazine (CAS 92-39-7) is a chemical compound with the molecular formula C12H8ClNS and a molecular weight of 233.72 g/mol. IUPAC name: 2-chloro-10H-phenothiazine. InChIKey: KFZGLJSYQXZIGP-UHFFFAOYSA-N.
| Molecular formula | C12H8ClNS |
|---|---|
| Molecular weight | 233.72 g/mol |
| IUPAC name | 2-chloro-10H-phenothiazine |
| InChIKey | KFZGLJSYQXZIGP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC3=C(S2)C=CC(=C3)Cl |
Computed by PubChem (NCBI)