cas: 1138444-10-6 — see every product listed under this CAS number, including other names
2-Chloro-3-((trimethylsilyl)ethynyl)pyridin-4-amine, 98% (CAS 1138444-10-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A769995-250mg |
| cas | 1138444-10-6 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 310.87 Pln | |
| Fluorochem | 100mg | 159.34 Pln | |
| Fluorochem | 250mg | 258.26 Pln | |
| Fluorochem | 1g | 862.21 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-chloro-3-(2-trimethylsilylethynyl)pyridin-4-amine (CAS 1138444-10-6) is a chemical compound with the molecular formula C10H13ClN2Si and a molecular weight of 224.76 g/mol. IUPAC name: 2-chloro-3-(2-trimethylsilylethynyl)pyridin-4-amine. InChIKey: XCPLDMMZZOBCFU-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2Si |
|---|---|
| Molecular weight | 224.76 g/mol |
| IUPAC name | 2-chloro-3-(2-trimethylsilylethynyl)pyridin-4-amine |
| InChIKey | XCPLDMMZZOBCFU-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#CC1=C(C=CN=C1Cl)N |
Computed by PubChem (NCBI)