cas: 1138444-10-6 — see every product listed under this CAS number, including other names
2-Chloro-3-[2-(trimethylsilyl)ethynyl]-4-pyridinamine, 98%, 98% (CAS 1138444-10-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1101HM-100mg |
| cas | 1138444-10-6 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 237.20 Pln | |
| Chemat | 1g | 722.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-chloro-3-(2-trimethylsilylethynyl)pyridin-4-amine (CAS 1138444-10-6) is a chemical compound with the molecular formula C10H13ClN2Si and a molecular weight of 224.76 g/mol. IUPAC name: 2-chloro-3-(2-trimethylsilylethynyl)pyridin-4-amine. InChIKey: XCPLDMMZZOBCFU-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2Si |
|---|---|
| Molecular weight | 224.76 g/mol |
| IUPAC name | 2-chloro-3-(2-trimethylsilylethynyl)pyridin-4-amine |
| InChIKey | XCPLDMMZZOBCFU-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C#CC1=C(C=CN=C1Cl)N |
Computed by PubChem (NCBI)