cas: 2068737-11-9 — see every product listed under this CAS number, including other names
2-Chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine, 97% (CAS 2068737-11-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F621414-1G |
| cas | 2068737-11-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1153.78 Pln | |
| Fluorochem | 100mg | 310.33 Pln | |
| Fluorochem | 250mg | 476.93 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine (CAS 2068737-11-9) is a chemical compound with the molecular formula C12H14BClF3NO2 and a molecular weight of 307.50 g/mol. IUPAC name: 2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine. InChIKey: JGYNUOKLWMKKRA-UHFFFAOYSA-N.
| Molecular formula | C12H14BClF3NO2 |
|---|---|
| Molecular weight | 307.50 g/mol |
| IUPAC name | 2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6-(trifluoromethyl)pyridine |
| InChIKey | JGYNUOKLWMKKRA-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(N=C(C=C2)C(F)(F)F)Cl |
Computed by PubChem (NCBI)