CAS 1622217-23-5 appears in our catalog under these names: 2-Chloro-4-(trifluoromethyl)pyridine-2-boronic acid pinacol ester, 98%, 2-Chloro-4-(trifluoromethyl)pyridine-2-boronic acid pinacol ester. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 50mg, 0,5g.
2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)pyridine (CAS 1622217-23-5) is a chemical compound with the molecular formula C12H14BClF3NO2 and a molecular weight of 307.50 g/mol. IUPAC name: 2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)pyridine. InChIKey: PTEWYLQNWCVNGU-UHFFFAOYSA-N.
| Molecular formula | C12H14BClF3NO2 |
|---|---|
| Molecular weight | 307.50 g/mol |
| IUPAC name | 2-chloro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-(trifluoromethyl)pyridine |
| InChIKey | PTEWYLQNWCVNGU-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=N2)Cl)C(F)(F)F |
Computed by PubChem (NCBI)